C27H24ClN5O3 — CID 134282939
1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 134282939) has the molecular formula C27H24ClN5O3 and a molecular weight of 501.97 g/mol. Its IUPAC name is 1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134282939 |
| Molecular Formula | C27H24ClN5O3 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1CNc1ncnc2[nH]cc(C(=O)c3ccc(Oc4ccccc4)cc3Cl)c12 |
| InChI | InChI=1S/C27H24ClN5O3/c1-2-23(34)33-12-6-7-17(33)14-29-26-24-21(15-30-27(24)32-16-31-26)25(35)20-11-10-19(13-22(20)28)36-18-8-4-3-5-9-18/h2-5,8-11,13,15-17H,1,6-7,12,14H2,(H2,29,30,31,32) |
| InChIKey | LBAYNVWBJUCBJY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|