About 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine
3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine (PubChem CID 134283142) has the molecular formula C6H5BrClN3
and a molecular weight of 234.48 g/mol. Its IUPAC name is 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine |
| PubChem CID | 134283142 |
| Molecular Formula | C6H5BrClN3 |
| Molecular Weight | 234.48 g/mol |
| Exact Mass | 232.94 |
| IUPAC Name | 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine |
| SMILES | ClC1=c2cc[nH]c2=NCN1Br |
| InChI | InChI=1S/C6H5BrClN3/c7-11-3-10-6-4(5(11)8)1-2-9-6/h1-2H,3H2,(H,9,10) |
| InChIKey | YVQPIGSRNMJPMW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.48 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine?
The IUPAC name of 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine (CID 134283142) is 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine is ClC1=c2cc[nH]c2=NCN1Br.
What is the InChIKey of 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine?
The InChIKey is YVQPIGSRNMJPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrClN3/c7-11-3-10-6-4(5(11)8)1-2-9-6/h1-2H,3H2,(H,9,10).
What are the key properties of 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine?
3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine has a molecular weight of 234.48 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-chloro-2,7-dihydropyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 134283142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).