C28H24ClN5O3 — CID 134283160
1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]but-2-yn-1-one (PubChem CID 134283160) has the molecular formula C28H24ClN5O3 and a molecular weight of 513.99 g/mol. Its IUPAC name is 1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 134283160 |
| Molecular Formula | C28H24ClN5O3 |
| Molecular Weight | 513.99 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCCC1CNc1ncnc2[nH]cc(C(=O)c3ccc(Oc4ccccc4)cc3Cl)c12 |
| InChI | InChI=1S/C28H24ClN5O3/c1-2-7-24(35)34-13-6-8-18(34)15-30-27-25-22(16-31-28(25)33-17-32-27)26(36)21-12-11-20(14-23(21)29)37-19-9-4-3-5-10-19/h3-5,9-12,14,16-18H,6,8,13,15H2,1H3,(H2,30,31,32,33) |
| InChIKey | FJFFSFQTZCRVNR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.99 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|