C29H29ClN6O4 — CID 134283258
N-[4-chloro-3-[4-[[(3R,6S)-6-(hydroxymethyl)oxan-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidine-5-carbonyl]phenyl]-5,6,7,8-tetrahydroisoquinoline-3-carboxamide (PubChem CID 134283258) has the molecular formula C29H29ClN6O4 and a molecular weight of 561.04 g/mol. Its IUPAC name is N-[4-chloro-3-[4-[[(3R,6S)-6-(hydroxymethyl)oxan-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidine-5-carbonyl]phenyl]-5,6,7,8-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | N-[4-chloro-3-[4-[[(3R,6S)-6-(hydroxymethyl)oxan-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidine-5-carbonyl]phenyl]-5,6,7,8-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 134283258 |
| Molecular Formula | C29H29ClN6O4 |
| Molecular Weight | 561.04 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | N-[4-chloro-3-[4-[[(3R,6S)-6-(hydroxymethyl)oxan-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidine-5-carbonyl]phenyl]-5,6,7,8-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(=O)c2c[nH]c3ncnc(N[C@@H]4CC[C@@H](CO)OC4)c23)c1)c1cc2c(cn1)CCCC2 |
| InChI | InChI=1S/C29H29ClN6O4/c30-23-8-6-18(36-29(39)24-9-16-3-1-2-4-17(16)11-31-24)10-21(23)26(38)22-12-32-27-25(22)28(34-15-33-27)35-19-5-7-20(13-37)40-14-19/h6,8-12,15,19-20,37H,1-5,7,13-14H2,(H,36,39)(H2,32,33,34,35)/t19-,20+/m1/s1 |
| InChIKey | FVNUBZKPCBEZFA-UXHICEINSA-N |
| XLogP | 4.32 |
| TPSA | 142.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.04 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |