About 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride
1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 134283914) has the molecular formula C11H20ClF3N2O2
and a molecular weight of 304.74 g/mol. Its IUPAC name is 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride |
| PubChem CID | 134283914 |
| Molecular Formula | C11H20ClF3N2O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CC(CF)C(C(O)C(F)F)N1CCCC1C(N)=O.Cl |
| InChI | InChI=1S/C11H19F3N2O2.ClH/c1-6(5-12)8(9(17)10(13)14)16-4-2-3-7(16)11(15)18;/h6-10,17H,2-5H2,1H3,(H2,15,18);1H |
| InChIKey | YRLQTEGPUKJSBW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride?
The IUPAC name of 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride (CID 134283914) is 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride.
What is the SMILES notation for 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride?
The canonical SMILES for 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride is CC(CF)C(C(O)C(F)F)N1CCCC1C(N)=O.Cl.
What is the InChIKey of 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride?
The InChIKey is YRLQTEGPUKJSBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O2.ClH/c1-6(5-12)8(9(17)10(13)14)16-4-2-3-7(16)11(15)18;/h6-10,17H,2-5H2,1H3,(H2,15,18);1H.
What are the key properties of 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride?
1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride has a molecular weight of 304.74 g/mol, XLogP of 0.96, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1,5-trifluoro-2-hydroxy-4-methylpentan-3-yl)pyrrolidine-2-carboxamide;hydrochloride is sourced from PubChem (CID 134283914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).