About 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine
6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine (PubChem CID 134284062) has the molecular formula C7H4F3N3O
and a molecular weight of 203.12 g/mol. Its IUPAC name is 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine |
| PubChem CID | 134284062 |
| Molecular Formula | C7H4F3N3O |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine |
| SMILES | Nc1nc2cc(C(F)(F)F)cnc2o1 |
| InChI | InChI=1S/C7H4F3N3O/c8-7(9,10)3-1-4-5(12-2-3)14-6(11)13-4/h1-2H,(H2,11,13) |
| InChIKey | OBUZQXCPIRMUQO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine?
The IUPAC name of 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine (CID 134284062) is 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine.
What is the SMILES notation for 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine?
The canonical SMILES for 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine is Nc1nc2cc(C(F)(F)F)cnc2o1.
What is the InChIKey of 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine?
The InChIKey is OBUZQXCPIRMUQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3N3O/c8-7(9,10)3-1-4-5(12-2-3)14-6(11)13-4/h1-2H,(H2,11,13).
What are the key properties of 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine?
6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine has a molecular weight of 203.12 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-[1,3]oxazolo[5,4-b]pyridin-2-amine is sourced from PubChem (CID 134284062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).