About 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine
6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine (PubChem CID 134284113) has the molecular formula C10H6ClN3O2
and a molecular weight of 235.63 g/mol. Its IUPAC name is 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine |
| PubChem CID | 134284113 |
| Molecular Formula | C10H6ClN3O2 |
| Molecular Weight | 235.63 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine |
| SMILES | Clc1ccc2nc(Nc3cnoc3)oc2c1 |
| InChI | InChI=1S/C10H6ClN3O2/c11-6-1-2-8-9(3-6)16-10(14-8)13-7-4-12-15-5-7/h1-5H,(H,13,14) |
| InChIKey | SWWZJVJEKIFQND-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.63 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine?
The IUPAC name of 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine (CID 134284113) is 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine.
What is the SMILES notation for 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine?
The canonical SMILES for 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine is Clc1ccc2nc(Nc3cnoc3)oc2c1.
What is the InChIKey of 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine?
The InChIKey is SWWZJVJEKIFQND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClN3O2/c11-6-1-2-8-9(3-6)16-10(14-8)13-7-4-12-15-5-7/h1-5H,(H,13,14).
What are the key properties of 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine?
6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine has a molecular weight of 235.63 g/mol, XLogP of 3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(1,2-oxazol-4-yl)-1,3-benzoxazol-2-amine is sourced from PubChem (CID 134284113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).