C26H21F4N3O6 — CID 134285023
(6R,7R)-7-[[(6R)-3-[(3,4-difluorophenyl)carbamoyl]-6-fluoro-1-oxalo-6,7-dihydro-5H-pyrrolizin-2-yl]methyl]-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylic acid (PubChem CID 134285023) has the molecular formula C26H21F4N3O6 and a molecular weight of 547.46 g/mol. Its IUPAC name is (6R,7R)-7-[[(6R)-3-[(3,4-difluorophenyl)carbamoyl]-6-fluoro-1-oxalo-6,7-dihydro-5H-pyrrolizin-2-yl]methyl]-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(6R)-3-[(3,4-difluorophenyl)carbamoyl]-6-fluoro-1-oxalo-6,7-dihydro-5H-pyrrolizin-2-yl]methyl]-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 134285023 |
| Molecular Formula | C26H21F4N3O6 |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | (6R,7R)-7-[[(6R)-3-[(3,4-difluorophenyl)carbamoyl]-6-fluoro-1-oxalo-6,7-dihydro-5H-pyrrolizin-2-yl]methyl]-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylic acid |
| SMILES | Cc1cc2n(c1C(=O)O)C[C@H](F)[C@@H]2Cc1c(C(=O)C(=O)O)c2n(c1C(=O)Nc1ccc(F)c(F)c1)C[C@H](F)C2 |
| InChI | InChI=1S/C26H21F4N3O6/c1-10-4-18-13(17(30)9-33(18)21(10)25(36)37)7-14-20(23(34)26(38)39)19-5-11(27)8-32(19)22(14)24(35)31-12-2-3-15(28)16(29)6-12/h2-4,6,11,13,17H,5,7-9H2,1H3,(H,31,35)(H,36,37)(H,38,39)/t11-,13+,17+/m1/s1 |
| InChIKey | PRPLAAYOMLYUIK-ZUCKAHLUSA-N |
| XLogP | 3.67 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|