C8H10N2O — CID 134285038
6,7-dihydro-5H-pyrrolizine-3-carboxamide (PubChem CID 134285038) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolizine-3-carboxamide.
| Compound Name | 6,7-dihydro-5H-pyrrolizine-3-carboxamide |
|---|---|
| PubChem CID | 134285038 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolizine-3-carboxamide |
| SMILES | NC(=O)c1ccc2n1CCC2 |
| InChI | InChI=1S/C8H10N2O/c9-8(11)7-4-3-6-2-1-5-10(6)7/h3-4H,1-2,5H2,(H2,9,11) |
| InChIKey | NLIFLQAHRVJVMD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |