C23H19ClF3N3O3 — CID 134285234
N-(3-chloro-4-fluorophenyl)-1-[2-[(1-ethynyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxamide (PubChem CID 134285234) has the molecular formula C23H19ClF3N3O3 and a molecular weight of 477.87 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-[2-[(1-ethynyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-[2-[(1-ethynyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxamide |
|---|---|
| PubChem CID | 134285234 |
| Molecular Formula | C23H19ClF3N3O3 |
| Molecular Weight | 477.87 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-[2-[(1-ethynyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxamide |
| SMILES | C#CC1(NC(=O)C(=O)c2c(C)c(C(=O)Nc3ccc(F)c(Cl)c3)n3c2CCC3)CC(F)(F)C1 |
| InChI | InChI=1S/C23H19ClF3N3O3/c1-3-22(10-23(26,27)11-22)29-21(33)19(31)17-12(2)18(30-8-4-5-16(17)30)20(32)28-13-6-7-15(25)14(24)9-13/h1,6-7,9H,4-5,8,10-11H2,2H3,(H,28,32)(H,29,33) |
| InChIKey | AMRLYSSGANCGGU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.87 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|