C22H19F3N6O3 — CID 134285246
2-methyl-1-[2-oxo-2-[[1-(2H-triazol-4-yl)cyclopropyl]amino]acetyl]-N-(2,3,4-trifluorophenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide (PubChem CID 134285246) has the molecular formula C22H19F3N6O3 and a molecular weight of 472.43 g/mol. Its IUPAC name is 2-methyl-1-[2-oxo-2-[[1-(2H-triazol-4-yl)cyclopropyl]amino]acetyl]-N-(2,3,4-trifluorophenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide.
| Compound Name | 2-methyl-1-[2-oxo-2-[[1-(2H-triazol-4-yl)cyclopropyl]amino]acetyl]-N-(2,3,4-trifluorophenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide |
|---|---|
| PubChem CID | 134285246 |
| Molecular Formula | C22H19F3N6O3 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2-methyl-1-[2-oxo-2-[[1-(2H-triazol-4-yl)cyclopropyl]amino]acetyl]-N-(2,3,4-trifluorophenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide |
| SMILES | Cc1c(C(=O)C(=O)NC2(c3cn[nH]n3)CC2)c2n(c1C(=O)Nc1ccc(F)c(F)c1F)CCC2 |
| InChI | InChI=1S/C22H19F3N6O3/c1-10-15(19(32)21(34)28-22(6-7-22)14-9-26-30-29-14)13-3-2-8-31(13)18(10)20(33)27-12-5-4-11(23)16(24)17(12)25/h4-5,9H,2-3,6-8H2,1H3,(H,27,33)(H,28,34)(H,26,29,30) |
| InChIKey | QMHZTQOYPKXGJC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|