About 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol
1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol (PubChem CID 134285685) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol.
Molecular Properties
| Compound Name | 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol |
| PubChem CID | 134285685 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol |
| SMILES | CC(c1ccc(C2(O)CCC(O)CC2)cc1)C(C)(C)C |
| InChI | InChI=1S/C18H28O2/c1-13(17(2,3)4)14-5-7-15(8-6-14)18(20)11-9-16(19)10-12-18/h5-8,13,16,19-20H,9-12H2,1-4H3 |
| InChIKey | SOYSRUOKHQRJMA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol?
The IUPAC name of 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol (CID 134285685) is 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol.
What is the SMILES notation for 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol?
The canonical SMILES for 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol is CC(c1ccc(C2(O)CCC(O)CC2)cc1)C(C)(C)C.
What is the InChIKey of 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol?
The InChIKey is SOYSRUOKHQRJMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-13(17(2,3)4)14-5-7-15(8-6-14)18(20)11-9-16(19)10-12-18/h5-8,13,16,19-20H,9-12H2,1-4H3.
What are the key properties of 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol?
1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol has a molecular weight of 276.42 g/mol, XLogP of 3.96, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,3-dimethylbutan-2-yl)phenyl]cyclohexane-1,4-diol is sourced from PubChem (CID 134285685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).