C16H33N — CID 134285692
2-tert-butyl-5-(3,3-dimethylbutyl)cyclohexan-1-amine (PubChem CID 134285692) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is 2-tert-butyl-5-(3,3-dimethylbutyl)cyclohexan-1-amine.
| Compound Name | 2-tert-butyl-5-(3,3-dimethylbutyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 134285692 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 2-tert-butyl-5-(3,3-dimethylbutyl)cyclohexan-1-amine |
| SMILES | CC(C)(C)CCC1CCC(C(C)(C)C)C(N)C1 |
| InChI | InChI=1S/C16H33N/c1-15(2,3)10-9-12-7-8-13(14(17)11-12)16(4,5)6/h12-14H,7-11,17H2,1-6H3 |
| InChIKey | OXMVHZRAQWQYPE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |