C17H25N5O6 — CID 134285762
2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-[2-(ethenylamino)hydrazinyl]-5-oxopentanoic acid (PubChem CID 134285762) has the molecular formula C17H25N5O6 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-[2-(ethenylamino)hydrazinyl]-5-oxopentanoic acid.
| Compound Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-[2-(ethenylamino)hydrazinyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 134285762 |
| Molecular Formula | C17H25N5O6 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-[2-(ethenylamino)hydrazinyl]-5-oxopentanoic acid |
| SMILES | C=CNNNC(=O)CCC(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C17H25N5O6/c1-2-18-21-20-14(24)8-7-12(17(27)28)19-13(23)6-4-3-5-11-22-15(25)9-10-16(22)26/h2,9-10,12,18,21H,1,3-8,11H2,(H,19,23)(H,20,24)(H,27,28) |
| InChIKey | ZLJPEPOGMMSAGW-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|