About 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline
1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline (PubChem CID 134286196) has the molecular formula C22H25N
and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline |
| PubChem CID | 134286196 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline |
| SMILES | CC=CC1(C2CC=CC=C2C2=NC=CC3C=CC=CC23)CC1C |
| InChI | InChI=1S/C22H25N/c1-3-13-22(15-16(22)2)20-11-7-6-10-19(20)21-18-9-5-4-8-17(18)12-14-23-21/h3-10,12-14,16-18,20H,11,15H2,1-2H3 |
| InChIKey | CXJUHXIUNFWXHO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline?
The IUPAC name of 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline (CID 134286196) is 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline.
What is the SMILES notation for 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline?
The canonical SMILES for 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline is CC=CC1(C2CC=CC=C2C2=NC=CC3C=CC=CC23)CC1C.
What is the InChIKey of 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline?
The InChIKey is CXJUHXIUNFWXHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N/c1-3-13-22(15-16(22)2)20-11-7-6-10-19(20)21-18-9-5-4-8-17(18)12-14-23-21/h3-10,12-14,16-18,20H,11,15H2,1-2H3.
What are the key properties of 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline?
1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline has a molecular weight of 303.45 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2-methyl-1-prop-1-enylcyclopropyl)cyclohexa-1,3-dien-1-yl]-4a,8a-dihydroisoquinoline is sourced from PubChem (CID 134286196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).