C27H30O7 — CID 134286261
[(1S,2S,5S,8R,9S,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7,15-dioxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] benzoate (PubChem CID 134286261) has the molecular formula C27H30O7 and a molecular weight of 466.53 g/mol. Its IUPAC name is [(1S,2S,5S,8R,9S,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7,15-dioxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] benzoate.
| Compound Name | [(1S,2S,5S,8R,9S,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7,15-dioxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] benzoate |
|---|---|
| PubChem CID | 134286261 |
| Molecular Formula | C27H30O7 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [(1S,2S,5S,8R,9S,10S,11R,18R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-7,15-dioxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] benzoate |
| SMILES | C=C1C(=O)[C@]23[C@H](OC(=O)c4ccccc4)[C@H]1CC[C@H]2[C@@]12CO[C@]3(O)[C@@H](O)[C@@H]1C(C)(C)CCC2=O |
| InChI | InChI=1S/C27H30O7/c1-14-16-9-10-17-25-13-33-27(32,21(30)19(25)24(2,3)12-11-18(25)28)26(17,20(14)29)22(16)34-23(31)15-7-5-4-6-8-15/h4-8,16-17,19,21-22,30,32H,1,9-13H2,2-3H3/t16-,17-,19+,21-,22+,25+,26-,27+/m0/s1 |
| InChIKey | UBNXGMYFKLPVOA-YCUOEASZSA-N |
| XLogP | 2.45 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|