C12H18FNO — CID 134286841
(7E)-8-fluoro-9-methoxy-N-methyldeca-1,2,4,7-tetraen-4-amine (PubChem CID 134286841) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is (7E)-8-fluoro-9-methoxy-N-methyldeca-1,2,4,7-tetraen-4-amine.
| Compound Name | (7E)-8-fluoro-9-methoxy-N-methyldeca-1,2,4,7-tetraen-4-amine |
|---|---|
| PubChem CID | 134286841 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (7E)-8-fluoro-9-methoxy-N-methyldeca-1,2,4,7-tetraen-4-amine |
| SMILES | C=C=CC(=CC/C=C(/F)C(C)OC)NC |
| InChI | InChI=1S/C12H18FNO/c1-5-7-11(14-3)8-6-9-12(13)10(2)15-4/h7-10,14H,1,6H2,2-4H3/b11-8?,12-9+ |
| InChIKey | WSLQYVZIPRNZDW-MHHZDMLJSA-N |
| XLogP | 2.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|