C23H38N2 — CID 134286904
(Z,3E)-3-[1-(ethylideneamino)ethylidene]-N-[(Z)-1-(3,3,5,5-tetramethylcyclohexyl)prop-1-enyl]hex-4-en-2-imine (PubChem CID 134286904) has the molecular formula C23H38N2 and a molecular weight of 342.57 g/mol. Its IUPAC name is (Z,3E)-3-[1-(ethylideneamino)ethylidene]-N-[(Z)-1-(3,3,5,5-tetramethylcyclohexyl)prop-1-enyl]hex-4-en-2-imine.
| Compound Name | (Z,3E)-3-[1-(ethylideneamino)ethylidene]-N-[(Z)-1-(3,3,5,5-tetramethylcyclohexyl)prop-1-enyl]hex-4-en-2-imine |
|---|---|
| PubChem CID | 134286904 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | (Z,3E)-3-[1-(ethylideneamino)ethylidene]-N-[(Z)-1-(3,3,5,5-tetramethylcyclohexyl)prop-1-enyl]hex-4-en-2-imine |
| SMILES | C/C=C\C(\C(C)=N/C(=C\C)C1CC(C)(C)CC(C)(C)C1)=C(C)/N=C/C |
| InChI | InChI=1S/C23H38N2/c1-10-13-20(17(4)24-12-3)18(5)25-21(11-2)19-14-22(6,7)16-23(8,9)15-19/h10-13,19H,14-16H2,1-9H3/b13-10-,20-17+,21-11-,24-12+,25-18+ |
| InChIKey | WNKBOWRFIDVDPI-KDOBLSSNSA-N |
| XLogP | 7.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|