C24H41N — CID 134286915
(Z)-3-ethenyl-N-[(Z)-1-(3-ethyl-3,5,5-trimethylcyclohexyl)prop-1-enyl]-4,5-dimethylhex-3-en-2-imine (PubChem CID 134286915) has the molecular formula C24H41N and a molecular weight of 343.60 g/mol. Its IUPAC name is (Z)-3-ethenyl-N-[(Z)-1-(3-ethyl-3,5,5-trimethylcyclohexyl)prop-1-enyl]-4,5-dimethylhex-3-en-2-imine.
| Compound Name | (Z)-3-ethenyl-N-[(Z)-1-(3-ethyl-3,5,5-trimethylcyclohexyl)prop-1-enyl]-4,5-dimethylhex-3-en-2-imine |
|---|---|
| PubChem CID | 134286915 |
| Molecular Formula | C24H41N |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.32 |
| IUPAC Name | (Z)-3-ethenyl-N-[(Z)-1-(3-ethyl-3,5,5-trimethylcyclohexyl)prop-1-enyl]-4,5-dimethylhex-3-en-2-imine |
| SMILES | C=CC(/C(C)=N\C(=C/C)C1CC(C)(C)CC(C)(CC)C1)=C(\C)C(C)C |
| InChI | InChI=1S/C24H41N/c1-11-21(18(6)17(4)5)19(7)25-22(12-2)20-14-23(8,9)16-24(10,13-3)15-20/h11-12,17,20H,1,13-16H2,2-10H3/b21-18-,22-12-,25-19+ |
| InChIKey | XXQMQDBYFDDGNP-BSPQYUDJSA-N |
| XLogP | 7.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|