C24H39N — CID 134286916
(3Z,4Z)-3-butan-2-ylidene-N-[(Z)-1-(3,3,5,5-tetramethylcyclohexyl)prop-1-enyl]hepta-4,6-dien-2-imine (PubChem CID 134286916) has the molecular formula C24H39N and a molecular weight of 341.58 g/mol. Its IUPAC name is (3Z,4Z)-3-butan-2-ylidene-N-[(Z)-1-(3,3,5,5-tetramethylcyclohexyl)prop-1-enyl]hepta-4,6-dien-2-imine.
| Compound Name | (3Z,4Z)-3-butan-2-ylidene-N-[(Z)-1-(3,3,5,5-tetramethylcyclohexyl)prop-1-enyl]hepta-4,6-dien-2-imine |
|---|---|
| PubChem CID | 134286916 |
| Molecular Formula | C24H39N |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.31 |
| IUPAC Name | (3Z,4Z)-3-butan-2-ylidene-N-[(Z)-1-(3,3,5,5-tetramethylcyclohexyl)prop-1-enyl]hepta-4,6-dien-2-imine |
| SMILES | C=C/C=C\C(=C(/C)CC)\C(C)=N\C(=C/C)C1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C24H39N/c1-10-13-14-21(18(4)11-2)19(5)25-22(12-3)20-15-23(6,7)17-24(8,9)16-20/h10,12-14,20H,1,11,15-17H2,2-9H3/b14-13-,21-18-,22-12-,25-19+ |
| InChIKey | KXPXMHMRQBEFFW-RIVHYXCASA-N |
| XLogP | 7.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|