C14H17FN2 — CID 134287012
2-ethyl-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-6-methylpyrimidine (PubChem CID 134287012) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-ethyl-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-6-methylpyrimidine.
| Compound Name | 2-ethyl-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-6-methylpyrimidine |
|---|---|
| PubChem CID | 134287012 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-ethyl-4-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-6-methylpyrimidine |
| SMILES | C=C(/C=C\C(F)=C/C)c1cc(C)nc(CC)n1 |
| InChI | InChI=1S/C14H17FN2/c1-5-12(15)8-7-10(3)13-9-11(4)16-14(6-2)17-13/h5,7-9H,3,6H2,1-2,4H3/b8-7-,12-5+ |
| InChIKey | HDNGZWHMXXETRR-KRMQVSRUSA-N |
| XLogP | 3.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|