About 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol
1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol (PubChem CID 134287066) has the molecular formula C16H18FNO
and a molecular weight of 259.32 g/mol. Its IUPAC name is 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol.
Molecular Properties
| Compound Name | 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol |
| PubChem CID | 134287066 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol |
| SMILES | C=C(O)c1cc(F)ccc1/C(C)=N/C=C\C=C\CC |
| InChI | InChI=1S/C16H18FNO/c1-4-5-6-7-10-18-12(2)15-9-8-14(17)11-16(15)13(3)19/h5-11,19H,3-4H2,1-2H3/b6-5+,10-7-,18-12+ |
| InChIKey | YHVPSJDQINVCSF-MQDHKDISSA-N |
| XLogP | 4.64 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol?
The IUPAC name of 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol (CID 134287066) is 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol.
What is the SMILES notation for 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol?
The canonical SMILES for 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol is C=C(O)c1cc(F)ccc1/C(C)=N/C=C\C=C\CC.
What is the InChIKey of 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol?
The InChIKey is YHVPSJDQINVCSF-MQDHKDISSA-N. The full InChI is InChI=1S/C16H18FNO/c1-4-5-6-7-10-18-12(2)15-9-8-14(17)11-16(15)13(3)19/h5-11,19H,3-4H2,1-2H3/b6-5+,10-7-,18-12+.
What are the key properties of 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol?
1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol has a molecular weight of 259.32 g/mol, XLogP of 4.64, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-fluoro-2-[N-[(1Z,3E)-hexa-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]ethenol is sourced from PubChem (CID 134287066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).