About N-oxo-2,1,3-benzothiadiazole-4-carboxamide
N-oxo-2,1,3-benzothiadiazole-4-carboxamide (PubChem CID 134287124) has the molecular formula C7H3N3O2S
and a molecular weight of 193.19 g/mol. Its IUPAC name is N-oxo-2,1,3-benzothiadiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-oxo-2,1,3-benzothiadiazole-4-carboxamide |
| PubChem CID | 134287124 |
| Molecular Formula | C7H3N3O2S |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 192.99 |
| IUPAC Name | N-oxo-2,1,3-benzothiadiazole-4-carboxamide |
| SMILES | O=NC(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C7H3N3O2S/c11-7(8-12)4-2-1-3-5-6(4)10-13-9-5/h1-3H |
| InChIKey | BIHBRSJGTJMGRF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-oxo-2,1,3-benzothiadiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxo-2,1,3-benzothiadiazole-4-carboxamide?
The IUPAC name of N-oxo-2,1,3-benzothiadiazole-4-carboxamide (CID 134287124) is N-oxo-2,1,3-benzothiadiazole-4-carboxamide.
What is the SMILES notation for N-oxo-2,1,3-benzothiadiazole-4-carboxamide?
The canonical SMILES for N-oxo-2,1,3-benzothiadiazole-4-carboxamide is O=NC(=O)c1cccc2nsnc12.
What is the InChIKey of N-oxo-2,1,3-benzothiadiazole-4-carboxamide?
The InChIKey is BIHBRSJGTJMGRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N3O2S/c11-7(8-12)4-2-1-3-5-6(4)10-13-9-5/h1-3H.
What are the key properties of N-oxo-2,1,3-benzothiadiazole-4-carboxamide?
N-oxo-2,1,3-benzothiadiazole-4-carboxamide has a molecular weight of 193.19 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxo-2,1,3-benzothiadiazole-4-carboxamide is sourced from PubChem (CID 134287124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).