C43H29F6N3O4 — CID 134287502
2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-dimethoxycarbazol-9-yl)benzonitrile (PubChem CID 134287502) has the molecular formula C43H29F6N3O4 and a molecular weight of 765.71 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-dimethoxycarbazol-9-yl)benzonitrile.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-dimethoxycarbazol-9-yl)benzonitrile |
|---|---|
| PubChem CID | 134287502 |
| Molecular Formula | C43H29F6N3O4 |
| Molecular Weight | 765.71 g/mol |
| Exact Mass | 765.21 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(3,6-dimethoxycarbazol-9-yl)benzonitrile |
| SMILES | COc1ccc2c(c1)c1cc(OC)ccc1n2-c1cc(C#N)c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1-n1c2ccc(OC)cc2c2cc(OC)ccc21 |
| InChI | InChI=1S/C43H29F6N3O4/c1-53-27-5-9-36-32(17-27)33-18-28(54-2)6-10-37(33)51(36)40-15-24(22-50)31(23-13-25(42(44,45)46)16-26(14-23)43(47,48)49)21-41(40)52-38-11-7-29(55-3)19-34(38)35-20-30(56-4)8-12-39(35)52/h5-21H,1-4H3 |
| InChIKey | SVQVCZUFMPXFSY-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 70.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.71 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |