C59H41F6N15 — CID 134287620
2,5-bis[3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-[3,5-bis(trifluoromethyl)phenyl]benzonitrile (PubChem CID 134287620) has the molecular formula C59H41F6N15 and a molecular weight of 1074.07 g/mol. Its IUPAC name is 2,5-bis[3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-[3,5-bis(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,5-bis[3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-[3,5-bis(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 134287620 |
| Molecular Formula | C59H41F6N15 |
| Molecular Weight | 1074.07 g/mol |
| Exact Mass | 1073.36 |
| IUPAC Name | 2,5-bis[3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-[3,5-bis(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2cc(-c4nc(C)nc(C)n4)ccc2n3-c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(-n3c4ccc(-c5nc(C)nc(C)n5)cc4c4cc(-c5nc(C)nc(C)n5)ccc43)cc2C#N)n1 |
| InChI | InChI=1S/C59H41F6N15/c1-27-67-28(2)72-54(71-27)35-9-13-48-44(19-35)45-20-36(55-73-29(3)68-30(4)74-55)10-14-49(45)79(48)52-25-43(39-17-41(58(60,61)62)24-42(18-39)59(63,64)65)53(23-40(52)26-66)80-50-15-11-37(56-75-31(5)69-32(6)76-56)21-46(50)47-22-38(12-16-51(47)80)57-77-33(7)70-34(8)78-57/h9-25H,1-8H3 |
| InChIKey | NUPRBEAIFGZVHH-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 188.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1074.07 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |