About N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine
N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine (PubChem CID 134287846) has the molecular formula C22H32N2
and a molecular weight of 324.51 g/mol. Its IUPAC name is N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine.
Molecular Properties
| Compound Name | N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine |
| PubChem CID | 134287846 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine |
| SMILES | C=CCCC(=C)N(C)C(C)C(C)CC1=CCC2(C)N=CC=CC2=C1 |
| InChI | InChI=1S/C22H32N2/c1-7-8-10-18(3)24(6)19(4)17(2)15-20-12-13-22(5)21(16-20)11-9-14-23-22/h7,9,11-12,14,16-17,19H,1,3,8,10,13,15H2,2,4-6H3 |
| InChIKey | UUXVZWURBMZYST-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine?
The IUPAC name of N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine (CID 134287846) is N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine.
What is the SMILES notation for N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine?
The canonical SMILES for N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine is C=CCCC(=C)N(C)C(C)C(C)CC1=CCC2(C)N=CC=CC2=C1.
What is the InChIKey of N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine?
The InChIKey is UUXVZWURBMZYST-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32N2/c1-7-8-10-18(3)24(6)19(4)17(2)15-20-12-13-22(5)21(16-20)11-9-14-23-22/h7,9,11-12,14,16-17,19H,1,3,8,10,13,15H2,2,4-6H3.
What are the key properties of N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine?
N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine has a molecular weight of 324.51 g/mol, XLogP of 5.47, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(8a-methyl-8H-quinolin-6-yl)-3-methylbutan-2-yl]-N-methylhexa-1,5-dien-2-amine is sourced from PubChem (CID 134287846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).