About 3-imino-3a,4,7,7a-tetrahydroinden-1-one
3-imino-3a,4,7,7a-tetrahydroinden-1-one (PubChem CID 134287895) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-imino-3a,4,7,7a-tetrahydroinden-1-one.
Molecular Properties
| Compound Name | 3-imino-3a,4,7,7a-tetrahydroinden-1-one |
| PubChem CID | 134287895 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-imino-3a,4,7,7a-tetrahydroinden-1-one |
| SMILES | [H]/N=C1\CC(=O)C2CC=CCC12 |
| InChI | InChI=1S/C9H11NO/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-2,6-7,10H,3-5H2/b10-8+ |
| InChIKey | KCPRIOYCVWAUQC-CSKARUKUSA-N |
| XLogP | 1.56 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-3a,4,7,7a-tetrahydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-3a,4,7,7a-tetrahydroinden-1-one?
The IUPAC name of 3-imino-3a,4,7,7a-tetrahydroinden-1-one (CID 134287895) is 3-imino-3a,4,7,7a-tetrahydroinden-1-one.
What is the SMILES notation for 3-imino-3a,4,7,7a-tetrahydroinden-1-one?
The canonical SMILES for 3-imino-3a,4,7,7a-tetrahydroinden-1-one is [H]/N=C1\CC(=O)C2CC=CCC12.
What is the InChIKey of 3-imino-3a,4,7,7a-tetrahydroinden-1-one?
The InChIKey is KCPRIOYCVWAUQC-CSKARUKUSA-N. The full InChI is InChI=1S/C9H11NO/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-2,6-7,10H,3-5H2/b10-8+.
What are the key properties of 3-imino-3a,4,7,7a-tetrahydroinden-1-one?
3-imino-3a,4,7,7a-tetrahydroinden-1-one has a molecular weight of 149.19 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-3a,4,7,7a-tetrahydroinden-1-one is sourced from PubChem (CID 134287895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).