C19H26N2 — CID 134287949
(3E,6Z,9E)-10-(4H-azepin-2-yl)-N,N,8-trimethyldeca-1,3,6,9-tetraen-4-amine (PubChem CID 134287949) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (3E,6Z,9E)-10-(4H-azepin-2-yl)-N,N,8-trimethyldeca-1,3,6,9-tetraen-4-amine.
| Compound Name | (3E,6Z,9E)-10-(4H-azepin-2-yl)-N,N,8-trimethyldeca-1,3,6,9-tetraen-4-amine |
|---|---|
| PubChem CID | 134287949 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (3E,6Z,9E)-10-(4H-azepin-2-yl)-N,N,8-trimethyldeca-1,3,6,9-tetraen-4-amine |
| SMILES | C=C/C=C(\C/C=C\C(C)/C=C/C1=CCC=CC=N1)N(C)C |
| InChI | InChI=1S/C19H26N2/c1-5-10-19(21(3)4)13-9-11-17(2)14-15-18-12-7-6-8-16-20-18/h5-6,8-12,14-17H,1,7,13H2,2-4H3/b11-9-,15-14+,19-10+ |
| InChIKey | CBOKJDPFBTVZOT-JTGURDTQSA-N |
| XLogP | 4.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|