C13H20N2 — CID 134288030
1,2-dimethyl-1-[(3E)-4-(4-methylcyclohexa-1,3-dien-1-yl)buta-1,3-dien-2-yl]hydrazine (PubChem CID 134288030) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(3E)-4-(4-methylcyclohexa-1,3-dien-1-yl)buta-1,3-dien-2-yl]hydrazine.
| Compound Name | 1,2-dimethyl-1-[(3E)-4-(4-methylcyclohexa-1,3-dien-1-yl)buta-1,3-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 134288030 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1,2-dimethyl-1-[(3E)-4-(4-methylcyclohexa-1,3-dien-1-yl)buta-1,3-dien-2-yl]hydrazine |
| SMILES | C=C(/C=C/C1=CC=C(C)CC1)N(C)NC |
| InChI | InChI=1S/C13H20N2/c1-11-5-8-13(9-6-11)10-7-12(2)15(4)14-3/h5,7-8,10,14H,2,6,9H2,1,3-4H3/b10-7+ |
| InChIKey | VTYXKMLJKLJSOD-JXMROGBWSA-N |
| XLogP | 2.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|