C18H25NO — CID 134288087
[2-[(2E,5Z,7E)-7-amino-3-methyl-4-methylidenenona-2,5,7-trien-2-yl]cyclohexa-1,3-dien-1-yl]methanol (PubChem CID 134288087) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is [2-[(2E,5Z,7E)-7-amino-3-methyl-4-methylidenenona-2,5,7-trien-2-yl]cyclohexa-1,3-dien-1-yl]methanol.
| Compound Name | [2-[(2E,5Z,7E)-7-amino-3-methyl-4-methylidenenona-2,5,7-trien-2-yl]cyclohexa-1,3-dien-1-yl]methanol |
|---|---|
| PubChem CID | 134288087 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | [2-[(2E,5Z,7E)-7-amino-3-methyl-4-methylidenenona-2,5,7-trien-2-yl]cyclohexa-1,3-dien-1-yl]methanol |
| SMILES | C=C(/C=C\C(N)=C/C)/C(C)=C(\C)C1=C(CO)CCC=C1 |
| InChI | InChI=1S/C18H25NO/c1-5-17(19)11-10-13(2)14(3)15(4)18-9-7-6-8-16(18)12-20/h5,7,9-11,20H,2,6,8,12,19H2,1,3-4H3/b11-10-,15-14+,17-5+ |
| InChIKey | DIJBPIFLZQENBN-JTRGKIPGSA-N |
| XLogP | 3.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|