C20H32O4 — CID 134288132
2-[[(2E,4Z)-6-[4,4-dimethyl-1-(oxiran-2-yl)hexan-2-yl]oxyhepta-2,4,6-trien-2-yl]oxymethyl]oxirane (PubChem CID 134288132) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 2-[[(2E,4Z)-6-[4,4-dimethyl-1-(oxiran-2-yl)hexan-2-yl]oxyhepta-2,4,6-trien-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[(2E,4Z)-6-[4,4-dimethyl-1-(oxiran-2-yl)hexan-2-yl]oxyhepta-2,4,6-trien-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 134288132 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 2-[[(2E,4Z)-6-[4,4-dimethyl-1-(oxiran-2-yl)hexan-2-yl]oxyhepta-2,4,6-trien-2-yl]oxymethyl]oxirane |
| SMILES | C=C(/C=C\C=C(/C)OCC1CO1)OC(CC1CO1)CC(C)(C)CC |
| InChI | InChI=1S/C20H32O4/c1-6-20(4,5)11-17(10-18-12-22-18)24-16(3)9-7-8-15(2)21-13-19-14-23-19/h7-9,17-19H,3,6,10-14H2,1-2,4-5H3/b9-7-,15-8+ |
| InChIKey | PUAJKUSABWTMBI-CXVZIJRBSA-N |
| XLogP | 4.38 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|