C26H31Cl2N3O2 — CID 134288513
(3R)-N-[1-(3-chloro-4-ethenoxyphenyl)-3-pyrrolidin-1-ylpropan-2-yl]-1-(4-chlorophenyl)pyrrolidine-3-carboxamide (PubChem CID 134288513) has the molecular formula C26H31Cl2N3O2 and a molecular weight of 488.46 g/mol. Its IUPAC name is (3R)-N-[1-(3-chloro-4-ethenoxyphenyl)-3-pyrrolidin-1-ylpropan-2-yl]-1-(4-chlorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[1-(3-chloro-4-ethenoxyphenyl)-3-pyrrolidin-1-ylpropan-2-yl]-1-(4-chlorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134288513 |
| Molecular Formula | C26H31Cl2N3O2 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | (3R)-N-[1-(3-chloro-4-ethenoxyphenyl)-3-pyrrolidin-1-ylpropan-2-yl]-1-(4-chlorophenyl)pyrrolidine-3-carboxamide |
| SMILES | C=COc1ccc(CC(CN2CCCC2)NC(=O)[C@@H]2CCN(c3ccc(Cl)cc3)C2)cc1Cl |
| InChI | InChI=1S/C26H31Cl2N3O2/c1-2-33-25-10-5-19(16-24(25)28)15-22(18-30-12-3-4-13-30)29-26(32)20-11-14-31(17-20)23-8-6-21(27)7-9-23/h2,5-10,16,20,22H,1,3-4,11-15,17-18H2,(H,29,32)/t20-,22?/m1/s1 |
| InChIKey | GTOCCAMZLBESIL-PSDZMVHGSA-N |
| XLogP | 5.17 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|