C18H24N4 — CID 134288718
2-[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]imino-N,1,3,5-tetramethyl-N-prop-2-enylimidazol-4-amine (PubChem CID 134288718) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]imino-N,1,3,5-tetramethyl-N-prop-2-enylimidazol-4-amine.
| Compound Name | 2-[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]imino-N,1,3,5-tetramethyl-N-prop-2-enylimidazol-4-amine |
|---|---|
| PubChem CID | 134288718 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]imino-N,1,3,5-tetramethyl-N-prop-2-enylimidazol-4-amine |
| SMILES | C=CCN(C)c1c(C)n(C)/c(=N\C2=C\C=C/CC#CC2)n1C |
| InChI | InChI=1S/C18H24N4/c1-6-14-20(3)17-15(2)21(4)18(22(17)5)19-16-12-10-8-7-9-11-13-16/h6,8,10,12H,1,7,13-14H2,2-5H3/b10-8-,16-12+,19-18+ |
| InChIKey | VOFVYPLGVQPHMS-LUPYKVTDSA-N |
| XLogP | 2.43 |
| TPSA | 25.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|