C24H24FN7O — CID 134289219
8-[(3S)-4-[[6-(6-fluoro-3-pyridinyl)pyrimidin-4-yl]amino]-3-methylbutan-2-yl]-N-methylquinazoline-4-carboxamide (PubChem CID 134289219) has the molecular formula C24H24FN7O and a molecular weight of 445.50 g/mol. Its IUPAC name is 8-[(3S)-4-[[6-(6-fluoro-3-pyridinyl)pyrimidin-4-yl]amino]-3-methylbutan-2-yl]-N-methylquinazoline-4-carboxamide.
| Compound Name | 8-[(3S)-4-[[6-(6-fluoro-3-pyridinyl)pyrimidin-4-yl]amino]-3-methylbutan-2-yl]-N-methylquinazoline-4-carboxamide |
|---|---|
| PubChem CID | 134289219 |
| Molecular Formula | C24H24FN7O |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 8-[(3S)-4-[[6-(6-fluoro-3-pyridinyl)pyrimidin-4-yl]amino]-3-methylbutan-2-yl]-N-methylquinazoline-4-carboxamide |
| SMILES | CNC(=O)c1ncnc2c(C(C)[C@H](C)CNc3cc(-c4ccc(F)nc4)ncn3)cccc12 |
| InChI | InChI=1S/C24H24FN7O/c1-14(10-28-21-9-19(29-12-30-21)16-7-8-20(25)27-11-16)15(2)17-5-4-6-18-22(17)31-13-32-23(18)24(33)26-3/h4-9,11-15H,10H2,1-3H3,(H,26,33)(H,28,29,30)/t14-,15?/m1/s1 |
| InChIKey | LKANJAWTHOMEDF-GICMACPYSA-N |
| XLogP | 3.83 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|