C12H10OS2 — CID 134289950
10-methyl-7-oxa-3,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13)-tetraene (PubChem CID 134289950) has the molecular formula C12H10OS2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 10-methyl-7-oxa-3,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13)-tetraene.
| Compound Name | 10-methyl-7-oxa-3,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13)-tetraene |
|---|---|
| PubChem CID | 134289950 |
| Molecular Formula | C12H10OS2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 10-methyl-7-oxa-3,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13)-tetraene |
| SMILES | CC1CCc2sc3c(oc4ccsc43)c21 |
| InChI | InChI=1S/C12H10OS2/c1-6-2-3-8-9(6)10-12(15-8)11-7(13-10)4-5-14-11/h4-6H,2-3H2,1H3 |
| InChIKey | HBJNXMWYUMOZPW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |