C11H9F6NO — CID 13429008
2-(2,3-dihydro-1H-indol-7-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 13429008) has the molecular formula C11H9F6NO and a molecular weight of 285.19 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indol-7-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2,3-dihydro-1H-indol-7-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 13429008 |
| Molecular Formula | C11H9F6NO |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-(2,3-dihydro-1H-indol-7-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1cccc2c1NCC2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F6NO/c12-10(13,14)9(19,11(15,16)17)7-3-1-2-6-4-5-18-8(6)7/h1-3,18-19H,4-5H2 |
| InChIKey | GDNRJZULOOHLTQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |