C14H9F12NO2 — CID 13429009
1,1,1,3,3,3-hexafluoro-2-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1H-indol-5-yl]propan-2-ol (PubChem CID 13429009) has the molecular formula C14H9F12NO2 and a molecular weight of 451.21 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1H-indol-5-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1H-indol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 13429009 |
| Molecular Formula | C14H9F12NO2 |
| Molecular Weight | 451.21 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1H-indol-5-yl]propan-2-ol |
| SMILES | OC(c1cc2c(c(C(O)(C(F)(F)F)C(F)(F)F)c1)NCC2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H9F12NO2/c15-11(16,17)9(28,12(18,19)20)6-3-5-1-2-27-8(5)7(4-6)10(29,13(21,22)23)14(24,25)26/h3-4,27-29H,1-2H2 |
| InChIKey | VFNOKICMYLWUQR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |