C14H28O3 — CID 134290095
2-[2-(2-methoxyethoxy)ethoxy]-3,3,4,4-tetramethylpent-1-ene (PubChem CID 134290095) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]-3,3,4,4-tetramethylpent-1-ene.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]-3,3,4,4-tetramethylpent-1-ene |
|---|---|
| PubChem CID | 134290095 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]-3,3,4,4-tetramethylpent-1-ene |
| SMILES | C=C(OCCOCCOC)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O3/c1-12(14(5,6)13(2,3)4)17-11-10-16-9-8-15-7/h1,8-11H2,2-7H3 |
| InChIKey | XPRPPEJHIGLIJF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|