C22H21F3N4O5 — CID 134290168
ethyl 3-(4,5-dimethoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylate (PubChem CID 134290168) has the molecular formula C22H21F3N4O5 and a molecular weight of 478.43 g/mol. Its IUPAC name is ethyl 3-(4,5-dimethoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylate.
| Compound Name | ethyl 3-(4,5-dimethoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylate |
|---|---|
| PubChem CID | 134290168 |
| Molecular Formula | C22H21F3N4O5 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | ethyl 3-(4,5-dimethoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylate |
| SMILES | CCOC(=O)c1nn(Cc2cc(F)c(F)c(F)c2)c(Nc2cc(OC)c(OC)cc2C)nc1=O |
| InChI | InChI=1S/C22H21F3N4O5/c1-5-34-21(31)19-20(30)27-22(26-15-9-17(33-4)16(32-3)6-11(15)2)29(28-19)10-12-7-13(23)18(25)14(24)8-12/h6-9H,5,10H2,1-4H3,(H,26,27,30) |
| InChIKey | FJIRRPOGOYNBAP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|