C20H18F4N4O3 — CID 134290170
3-(4,5-dimethoxy-2-methylanilino)-6-(fluoromethyl)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one (PubChem CID 134290170) has the molecular formula C20H18F4N4O3 and a molecular weight of 438.38 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-methylanilino)-6-(fluoromethyl)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-(4,5-dimethoxy-2-methylanilino)-6-(fluoromethyl)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 134290170 |
| Molecular Formula | C20H18F4N4O3 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 3-(4,5-dimethoxy-2-methylanilino)-6-(fluoromethyl)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
| SMILES | COc1cc(C)c(Nc2nc(=O)c(CF)nn2Cc2cc(F)c(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C20H18F4N4O3/c1-10-4-16(30-2)17(31-3)7-14(10)25-20-26-19(29)15(8-21)27-28(20)9-11-5-12(22)18(24)13(23)6-11/h4-7H,8-9H2,1-3H3,(H,25,26,29) |
| InChIKey | VMOCRDBKCYAJOP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|