C24H24N2O10 — CID 13429018
oxiran-2-ylmethyl 4-[2-[4-(oxiran-2-ylmethoxy)-4-oxobutyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]butanoate (PubChem CID 13429018) has the molecular formula C24H24N2O10 and a molecular weight of 500.46 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4-[2-[4-(oxiran-2-ylmethoxy)-4-oxobutyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]butanoate.
| Compound Name | oxiran-2-ylmethyl 4-[2-[4-(oxiran-2-ylmethoxy)-4-oxobutyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]butanoate |
|---|---|
| PubChem CID | 13429018 |
| Molecular Formula | C24H24N2O10 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | oxiran-2-ylmethyl 4-[2-[4-(oxiran-2-ylmethoxy)-4-oxobutyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]butanoate |
| SMILES | O=C(CCCn1c(=O)c2cc3c(=O)n(CCCC(=O)OCC4CO4)c(=O)c3cc2c1=O)OCC1CO1 |
| InChI | InChI=1S/C24H24N2O10/c27-19(35-11-13-9-33-13)3-1-5-25-21(29)15-7-17-18(8-16(15)22(25)30)24(32)26(23(17)31)6-2-4-20(28)36-12-14-10-34-14/h7-8,13-14H,1-6,9-12H2 |
| InChIKey | FYVOBMWVRGLPRQ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 155.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|