About 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one
1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one (PubChem CID 134290202) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one.
Molecular Properties
| Compound Name | 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one |
| PubChem CID | 134290202 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one |
| SMILES | COc1cn(Cc2ccccc2)c(NCc2c(C)cccc2C)nc1=O |
| InChI | InChI=1S/C21H23N3O2/c1-15-8-7-9-16(2)18(15)12-22-21-23-20(25)19(26-3)14-24(21)13-17-10-5-4-6-11-17/h4-11,14H,12-13H2,1-3H3,(H,22,23,25) |
| InChIKey | FFDIGITYMJGBTA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one?
The IUPAC name of 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one (CID 134290202) is 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one.
What is the SMILES notation for 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one?
The canonical SMILES for 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one is COc1cn(Cc2ccccc2)c(NCc2c(C)cccc2C)nc1=O.
What is the InChIKey of 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one?
The InChIKey is FFDIGITYMJGBTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2/c1-15-8-7-9-16(2)18(15)12-22-21-23-20(25)19(26-3)14-24(21)13-17-10-5-4-6-11-17/h4-11,14H,12-13H2,1-3H3,(H,22,23,25).
What are the key properties of 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one?
1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one has a molecular weight of 349.43 g/mol, XLogP of 3.53, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-[(2,6-dimethylphenyl)methylamino]-5-methoxypyrimidin-4-one is sourced from PubChem (CID 134290202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).