About 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one
2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one (PubChem CID 134290359) has the molecular formula C22H24FN3O4
and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one |
| PubChem CID | 134290359 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one |
| SMILES | CCc1cc(OC)c(OC)cc1Nc1nc(=O)c(OC)cn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN3O4/c1-5-15-10-18(28-2)19(29-3)11-17(15)24-22-25-21(27)20(30-4)13-26(22)12-14-6-8-16(23)9-7-14/h6-11,13H,5,12H2,1-4H3,(H,24,25,27) |
| InChIKey | NGSMNVIVVXGXSK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one?
The IUPAC name of 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one (CID 134290359) is 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one.
What is the SMILES notation for 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one?
The canonical SMILES for 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one is CCc1cc(OC)c(OC)cc1Nc1nc(=O)c(OC)cn1Cc1ccc(F)cc1.
What is the InChIKey of 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one?
The InChIKey is NGSMNVIVVXGXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24FN3O4/c1-5-15-10-18(28-2)19(29-3)11-17(15)24-22-25-21(27)20(30-4)13-26(22)12-14-6-8-16(23)9-7-14/h6-11,13H,5,12H2,1-4H3,(H,24,25,27).
What are the key properties of 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one?
2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one has a molecular weight of 413.45 g/mol, XLogP of 3.76, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-4,5-dimethoxyanilino)-1-[(4-fluorophenyl)methyl]-5-methoxypyrimidin-4-one is sourced from PubChem (CID 134290359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).