About 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one
1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one (PubChem CID 134290511) has the molecular formula C21H21F2N3O3
and a molecular weight of 401.41 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one.
Molecular Properties
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one |
| PubChem CID | 134290511 |
| Molecular Formula | C21H21F2N3O3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one |
| SMILES | CCc1cc(OC)ccc1Nc1nc(=O)c(OC)cn1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H21F2N3O3/c1-4-14-10-15(28-2)6-8-18(14)24-21-25-20(27)19(29-3)12-26(21)11-13-5-7-16(22)17(23)9-13/h5-10,12H,4,11H2,1-3H3,(H,24,25,27) |
| InChIKey | ALBXKJDWLVJGKG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one?
The IUPAC name of 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one (CID 134290511) is 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one.
What is the SMILES notation for 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one?
The canonical SMILES for 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one is CCc1cc(OC)ccc1Nc1nc(=O)c(OC)cn1Cc1ccc(F)c(F)c1.
What is the InChIKey of 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one?
The InChIKey is ALBXKJDWLVJGKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F2N3O3/c1-4-14-10-15(28-2)6-8-18(14)24-21-25-20(27)19(29-3)12-26(21)11-13-5-7-16(22)17(23)9-13/h5-10,12H,4,11H2,1-3H3,(H,24,25,27).
What are the key properties of 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one?
1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one has a molecular weight of 401.41 g/mol, XLogP of 3.89, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-difluorophenyl)methyl]-2-(2-ethyl-4-methoxyanilino)-5-methoxypyrimidin-4-one is sourced from PubChem (CID 134290511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).