C24H26F2N4O3 — CID 134290918
N-butyl-N-[3-[[1-[(3,5-difluorophenyl)methyl]-5-methoxy-4-oxopyrimidin-2-yl]amino]-4-methylphenyl]formamide (PubChem CID 134290918) has the molecular formula C24H26F2N4O3 and a molecular weight of 456.49 g/mol. Its IUPAC name is N-butyl-N-[3-[[1-[(3,5-difluorophenyl)methyl]-5-methoxy-4-oxopyrimidin-2-yl]amino]-4-methylphenyl]formamide.
| Compound Name | N-butyl-N-[3-[[1-[(3,5-difluorophenyl)methyl]-5-methoxy-4-oxopyrimidin-2-yl]amino]-4-methylphenyl]formamide |
|---|---|
| PubChem CID | 134290918 |
| Molecular Formula | C24H26F2N4O3 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-butyl-N-[3-[[1-[(3,5-difluorophenyl)methyl]-5-methoxy-4-oxopyrimidin-2-yl]amino]-4-methylphenyl]formamide |
| SMILES | CCCCN(C=O)c1ccc(C)c(Nc2nc(=O)c(OC)cn2Cc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C24H26F2N4O3/c1-4-5-8-29(15-31)20-7-6-16(2)21(12-20)27-24-28-23(32)22(33-3)14-30(24)13-17-9-18(25)11-19(26)10-17/h6-7,9-12,14-15H,4-5,8,13H2,1-3H3,(H,27,28,32) |
| InChIKey | XWGQBSQWGZSZHA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|