C19H14F4N4O — CID 134290999
2-(2,3-dihydro-1H-indol-4-ylamino)-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134290999) has the molecular formula C19H14F4N4O and a molecular weight of 390.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indol-4-ylamino)-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 2-(2,3-dihydro-1H-indol-4-ylamino)-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134290999 |
| Molecular Formula | C19H14F4N4O |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-(2,3-dihydro-1H-indol-4-ylamino)-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | O=c1nc(Nc2cccc3c2CCN3)n(Cc2cc(F)c(F)c(F)c2)cc1F |
| InChI | InChI=1S/C19H14F4N4O/c20-12-6-10(7-13(21)17(12)23)8-27-9-14(22)18(28)26-19(27)25-16-3-1-2-15-11(16)4-5-24-15/h1-3,6-7,9,24H,4-5,8H2,(H,25,26,28) |
| InChIKey | TUYVKEHVSWJCKO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|