C25H24ClFN4O2 — CID 134291041
1-[(3-chloro-4-fluorophenyl)methyl]-2-[5-(2,5-dimethylpyrrol-1-yl)-2-methylanilino]-5-methoxypyrimidin-4-one (PubChem CID 134291041) has the molecular formula C25H24ClFN4O2 and a molecular weight of 466.94 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-2-[5-(2,5-dimethylpyrrol-1-yl)-2-methylanilino]-5-methoxypyrimidin-4-one.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-2-[5-(2,5-dimethylpyrrol-1-yl)-2-methylanilino]-5-methoxypyrimidin-4-one |
|---|---|
| PubChem CID | 134291041 |
| Molecular Formula | C25H24ClFN4O2 |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-2-[5-(2,5-dimethylpyrrol-1-yl)-2-methylanilino]-5-methoxypyrimidin-4-one |
| SMILES | COc1cn(Cc2ccc(F)c(Cl)c2)c(Nc2cc(-n3c(C)ccc3C)ccc2C)nc1=O |
| InChI | InChI=1S/C25H24ClFN4O2/c1-15-5-9-19(31-16(2)6-7-17(31)3)12-22(15)28-25-29-24(32)23(33-4)14-30(25)13-18-8-10-21(27)20(26)11-18/h5-12,14H,13H2,1-4H3,(H,28,29,32) |
| InChIKey | CCFFCYFOFIIMMB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|