C22H22F3N3O4 — CID 134291123
2-(4,5-dimethoxy-2-methylanilino)-5-(methoxymethyl)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134291123) has the molecular formula C22H22F3N3O4 and a molecular weight of 449.43 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylanilino)-5-(methoxymethyl)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 2-(4,5-dimethoxy-2-methylanilino)-5-(methoxymethyl)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134291123 |
| Molecular Formula | C22H22F3N3O4 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylanilino)-5-(methoxymethyl)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | COCc1cn(Cc2cc(F)c(F)c(F)c2)c(Nc2cc(OC)c(OC)cc2C)nc1=O |
| InChI | InChI=1S/C22H22F3N3O4/c1-12-5-18(31-3)19(32-4)8-17(12)26-22-27-21(29)14(11-30-2)10-28(22)9-13-6-15(23)20(25)16(24)7-13/h5-8,10H,9,11H2,1-4H3,(H,26,27,29) |
| InChIKey | NPGQFTJOIFWBRJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|