C19H13F4N5O — CID 134291166
5-fluoro-2-[(6-methyl-1H-indazol-5-yl)amino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134291166) has the molecular formula C19H13F4N5O and a molecular weight of 403.34 g/mol. Its IUPAC name is 5-fluoro-2-[(6-methyl-1H-indazol-5-yl)amino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 5-fluoro-2-[(6-methyl-1H-indazol-5-yl)amino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134291166 |
| Molecular Formula | C19H13F4N5O |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 5-fluoro-2-[(6-methyl-1H-indazol-5-yl)amino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | Cc1cc2[nH]ncc2cc1Nc1nc(=O)c(F)cn1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H13F4N5O/c1-9-2-16-11(6-24-27-16)5-15(9)25-19-26-18(29)14(22)8-28(19)7-10-3-12(20)17(23)13(21)4-10/h2-6,8H,7H2,1H3,(H,24,27)(H,25,26,29) |
| InChIKey | DULGQDYLUAJFTM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|