C20H13ClF3N5O2 — CID 134291194
5-chloro-2-[2-methyl-5-(1,3,4-oxadiazol-2-yl)anilino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134291194) has the molecular formula C20H13ClF3N5O2 and a molecular weight of 447.80 g/mol. Its IUPAC name is 5-chloro-2-[2-methyl-5-(1,3,4-oxadiazol-2-yl)anilino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 5-chloro-2-[2-methyl-5-(1,3,4-oxadiazol-2-yl)anilino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134291194 |
| Molecular Formula | C20H13ClF3N5O2 |
| Molecular Weight | 447.80 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 5-chloro-2-[2-methyl-5-(1,3,4-oxadiazol-2-yl)anilino]-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2nnco2)cc1Nc1nc(=O)c(Cl)cn1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C20H13ClF3N5O2/c1-10-2-3-12(19-28-25-9-31-19)6-16(10)26-20-27-18(30)13(21)8-29(20)7-11-4-14(22)17(24)15(23)5-11/h2-6,8-9H,7H2,1H3,(H,26,27,30) |
| InChIKey | VUDGTOZBPJANJZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|